3,5-Dinitro-4-hydroxybenzoic acid

نام محصول	3,5-Dinitro-4-hydroxybenzoic acid
مترادف	4-Hydroxy-3,5-dinitrobenzoic acid; 3,5-dinitro-4-oxidobenzoate
میدان مغناطیسی	C₇H₂N₂O₇
وزن مولکولی	226.1011
InChI	InChI=1/C7H4N2O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H,(H,11,12)/p-2
شماره سیایاس	1019-52-9
تعداد کمیسیون اروپایی	213-814-8
ساختار مولکولی
نقطه ذوب	249-252℃
نقطه غلیان	349.4°C at 760 mmHg
نقطه اشتعال	155.7°C
کدهای خطر	R36/37/38:Irritating to eyes, respiratory system and skin.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;