نام محصول |
3,5-Dinitro-4-hydroxybenzoic acid |
مترادف |
4-Hydroxy-3,5-dinitrobenzoic acid; 3,5-dinitro-4-oxidobenzoate |
میدان مغناطیسی |
C7H2N2O7 |
وزن مولکولی |
226.1011 |
InChI |
InChI=1/C7H4N2O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H,(H,11,12)/p-2 |
شماره سیایاس |
1019-52-9 |
تعداد کمیسیون اروپایی |
213-814-8 |
ساختار مولکولی |
|
نقطه ذوب |
249-252℃ |
نقطه غلیان |
349.4°C at 760 mmHg |
نقطه اشتعال |
155.7°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|