상품명칭 |
3,5-Dinitro-4-hydroxybenzoic acid |
별명 |
4-Hydroxy-3,5-dinitrobenzoic acid; 3,5-dinitro-4-oxidobenzoate |
분자식 |
C7H2N2O7 |
분자량 |
226.1011 |
InChI |
InChI=1/C7H4N2O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H,(H,11,12)/p-2 |
cas번호 |
1019-52-9 |
EC번호 |
213-814-8 |
분자 구조 |
|
녹는 점 |
249-252℃ |
비등점 |
349.4°C at 760 mmHg |
인화점 |
155.7°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|