product Name |
Tributyl phosphite |
Synonyms |
Tri-n-butyl phosphite |
Molecular Formula |
C12H27O3P |
Molecular Weight |
250.3147 |
InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
CAS Registry Number |
102-85-2 |
EINECS |
203-061-3 |
Molecular Structure |
|
Melting point |
-80℃ |
Boiling point |
268.1°C at 760 mmHg |
Flash point |
121.1°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|