उत्पाद का नाम |
Tributyl phosphite |
समानार्थी |
Tri-n-butyl phosphite |
आणविक फार्मूला |
C12H27O3P |
आण्विक वजन |
250.3147 |
InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
कैस रजिस्टी संख्या |
102-85-2 |
EINECS |
203-061-3 |
आणविक संरचना |
|
गलनांक |
-80℃ |
उबलने का समय |
268.1°C at 760 mmHg |
फ्लैश प्वाइंट |
121.1°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|