product Name |
5-Ethylpyridine-2,3-dicarboxylic acid |
Synonyms |
5-Ethylquinolinic acid; 5-ethyl-2,3-pyridinedicarboxylic acid; Imazethapyr intermediate |
Molecular Formula |
C9H9NO4 |
Molecular Weight |
195.1721 |
InChI |
InChI=1/C9H9NO4/c1-2-5-3-6(8(11)12)7(9(13)14)10-4-5/h3-4H,2H2,1H3,(H,11,12)(H,13,14) |
CAS Registry Number |
102268-15-5 |
Molecular Structure |
|
Density |
1.388g/cm3 |
Boiling point |
421.2°C at 760 mmHg |
Refractive index |
1.595 |
Flash point |
208.5°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|