Naam product |
5-Ethylpyridine-2,3-dicarboxylic acid |
Synoniemen |
5-Ethylquinolinic acid; 5-ethyl-2,3-pyridinedicarboxylic acid; Imazethapyr intermediate |
MF |
C9H9NO4 |
Molecuulgewicht |
195.1721 |
InChI |
InChI=1/C9H9NO4/c1-2-5-3-6(8(11)12)7(9(13)14)10-4-5/h3-4H,2H2,1H3,(H,11,12)(H,13,14) |
CAS-nummer |
102268-15-5 |
Moleculaire Structuur |
|
Dichtheid |
1.388g/cm3 |
Kookpunt |
421.2°C at 760 mmHg |
Brekingsindex |
1.595 |
Vlampunt |
208.5°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|