trans-2-Heptenoic acid

שם המוצר	trans-2-Heptenoic acid
נרדפות	Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid
מולקולרית פורמולה	C₇H₁₂O₂
משקל מולקולרי	128.169
InChI	InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+
מספר CAS	10352-88-2
EINECS	233-769-8
מבנה מולקולרי
צפיפות	0.968g/cm³
נקודת רתיחה	226.6°C at 760 mmHg
משקל סגולי	1.457
נקודת הבזק	133.4°C
סיכונים קודי	R34:Causes burns.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;