Nama produk |
trans-2-Heptenoic acid |
Sinonim |
Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
MF |
C7H12O2 |
Berat Molekul |
128.169 |
InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
CAS NO |
10352-88-2 |
EINECS |
233-769-8 |
Struktur Molekul |
|
Kepadatan |
0.968g/cm3 |
Titik didih |
226.6°C at 760 mmHg |
Indeks bias |
1.457 |
Titik nyala |
133.4°C |
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|