Nome del prodotto |
(4-Aminophenylthio)acetic acid |
Sinonimi |
2-(4-Aminophenylthio)acetic acid; 4-Aminothiophenoxyacetic acid; [(4-aminophenyl)sulfanyl]acetic acid; [(4-aminophenyl)sulfanyl]acetate |
Formula molecolare |
C8H8NO2S |
Peso Molecolare |
182.2202 |
InChI |
InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
Numero CAS |
104-18-7 |
EINECS |
203-182-1 |
Struttura molecolare |
|
Punto di ebollizione |
405.3°C at 760 mmHg |
Punto d'infiammabilità |
198.9°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|