Nazwa produktu: |
(4-Aminophenylthio)acetic acid |
Synonimy |
2-(4-Aminophenylthio)acetic acid; 4-Aminothiophenoxyacetic acid; [(4-aminophenyl)sulfanyl]acetic acid; [(4-aminophenyl)sulfanyl]acetate |
MF |
C8H8NO2S |
Masie cząsteczkowej |
182.2202 |
InChI |
InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
Nr CAS |
104-18-7 |
EINECS |
203-182-1 |
Struktury molekularnej |
|
Temperatura wrzenia |
405.3°C at 760 mmHg |
Temperatura zapłonu |
198.9°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|