نام محصول |
Anethole |
مترادف |
Anise camphor; 1-(p-methoxyphenyl)propene; 1-methoxy-4-(1-propenyl)benzene; 1-methoxy-4-propenylbenzene; p-1-propenylanisole; p-methoxy-beta-methylstyrene; p-propenylphenyl methyl ether; isoestragole; Methoxy-4-propenylbenzene; nauli ''gum''; oil of aniseed; Propenylanisole; 1-methoxy-4-[(1E)-prop-1-en-1-yl]benzene; 1-methoxy-4-[(1Z)-prop-1-en-1-yl]benzene; Anethol |
میدان مغناطیسی |
C10H12O |
وزن مولکولی |
148.2017 |
InChI |
InChI=1/C10H12O/c1-3-10(11-2)9-7-5-4-6-8-9/h3-8H,1-2H3 |
شماره سیایاس |
104-46-1 |
تعداد کمیسیون اروپایی |
203-205-5 |
ساختار مولکولی |
|
نقطه ذوب |
23-22℃ |
ضریب شکست |
1.514 |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|