Ürün Adı |
Anethole |
Eş anlamlı |
Anise camphor; 1-(p-methoxyphenyl)propene; 1-methoxy-4-(1-propenyl)benzene; 1-methoxy-4-propenylbenzene; p-1-propenylanisole; p-methoxy-beta-methylstyrene; p-propenylphenyl methyl ether; isoestragole; Methoxy-4-propenylbenzene; nauli ''gum''; oil of aniseed; Propenylanisole; 1-methoxy-4-[(1E)-prop-1-en-1-yl]benzene; 1-methoxy-4-[(1Z)-prop-1-en-1-yl]benzene; Anethol |
Moleküler Formülü |
C10H12O |
Molekül Ağırlığı |
148.2017 |
InChI |
InChI=1/C10H12O/c1-3-10(11-2)9-7-5-4-6-8-9/h3-8H,1-2H3 |
CAS kayıt numarası |
104-46-1 |
EINECS |
203-205-5 |
Moleküler Yapısı |
|
Ergime noktası |
23-22℃ |
Kırılma indisi |
1.514 |
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|