Nazwa produktu: |
3,5-Dimethoxyphenyl isothiocyanate |
Synonimy |
1-isothiocyanato-3,5-dimethoxybenzene |
MF |
C9H9NO2S |
Masie cząsteczkowej |
195.2383 |
InChI |
InChI=1/C9H9NO2S/c1-11-8-3-7(10-6-13)4-9(5-8)12-2/h3-5H,1-2H3 |
Nr CAS |
104968-58-3 |
Struktury molekularnej |
|
Gęstość |
1.12g/cm3 |
Temperatura topnienia |
50-52℃ |
Temperatura wrzenia |
338.1°C at 760 mmHg |
Współczynnik załamania |
1.537 |
Temperatura zapłonu |
158.3°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|