Название продукта |
3,5-Dimethoxyphenyl isothiocyanate |
Синонимы |
1-isothiocyanato-3,5-dimethoxybenzene |
Молекулярная формула |
C9H9NO2S |
Молекулярный вес |
195.2383 |
InChI |
InChI=1/C9H9NO2S/c1-11-8-3-7(10-6-13)4-9(5-8)12-2/h3-5H,1-2H3 |
Регистрационный номер CAS |
104968-58-3 |
Молекулярная структура |
|
Плотность |
1.12g/cm3 |
Температура плавления |
50-52℃ |
Точка кипения |
338.1°C at 760 mmHg |
Показатель преломления |
1.537 |
Температура вспышки |
158.3°C |
Символы опасности |
Xn:Harmful;
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|