שם המוצר |
Hexaaminecobalt(III) chloride |
נרדפות |
Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
מולקולרית פורמולה |
C6H12ClCoN4 |
משקל מולקולרי |
234.5719 |
InChI |
InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
מספר CAS |
10534-89-1 |
EINECS |
234-103-9 |
מבנה מולקולרי |
|
נקודת ההתוך |
217℃ |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|