اسم المنتج |
Hexaaminecobalt(III) chloride |
الاسم المستعار |
Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
الصيغة الجزيئية |
C6H12ClCoN4 |
الوزن الجزيئي الغرامي |
234.5719 |
InChI |
InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
إستراتيجية المساعدة القطرية |
10534-89-1 |
المفوضية الأوروبية رقم |
234-103-9 |
بنية جزيئية |
|
درجة الإنصهار |
217℃ |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|