उत्पाद का नाम |
butyl myristate |
समानार्थी |
n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester; Myristicacidnbutylester; Myristic acid n-butyl ester; butyl tetradecanoate |
आणविक फार्मूला |
C18H36O2 |
आण्विक वजन |
284.4772 |
InChI |
InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
कैस रजिस्टी संख्या |
110-36-1 |
EINECS |
203-759-8 |
आणविक संरचना |
|
घनत्व |
0.864g/cm3 |
उबलने का समय |
334.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.442 |
फ्लैश प्वाइंट |
158.5°C |
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|