Nama produk |
butyl myristate |
Sinonim |
n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester; Myristicacidnbutylester; Myristic acid n-butyl ester; butyl tetradecanoate |
MF |
C18H36O2 |
Berat Molekul |
284.4772 |
InChI |
InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
CAS NO |
110-36-1 |
EINECS |
203-759-8 |
Struktur Molekul |
|
Kepadatan |
0.864g/cm3 |
Titik didih |
334.7°C at 760 mmHg |
Indeks bias |
1.442 |
Titik nyala |
158.5°C |
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|