Methyl 2-nonynoate

Ονομασία του προϊόντος	Methyl 2-nonynoate
Συνώνυμα	2-Nonynoic acid methyl ester; 2-Nonynoic acid, methyl ester; Methyl octin carbonate; Methyl octine carbonate; Octynecarboxylic acid, methyl ester; methyl non-2-ynoate
MF	C₁₀H₁₆O₂
Μοριακό βάρος	168.2328
InChI	InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3
CAS ΟΧΙ	111-80-8
EINECS	203-909-2
Μοριακή δομή
Πυκνότητα	0.932g/cm³
Σημείο βρασμού	233.1°C at 760 mmHg
Δείκτης διάθλασης	1.446
Σημείο ανάφλεξης	100.6°C
Σύμβολα επικινδυνότητας	Xi:Irritant;
Κινδύνου Κώδικες	R36/38:Irritating to eyes and skin.;
Περιγραφή της ασφάλειας	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;