Nama produk |
Methyl 2-nonynoate |
Sinonim |
2-Nonynoic acid methyl ester; 2-Nonynoic acid, methyl ester; Methyl octin carbonate; Methyl octine carbonate; Octynecarboxylic acid, methyl ester; methyl non-2-ynoate |
MF |
C10H16O2 |
Berat Molekul |
168.2328 |
InChI |
InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
CAS NO |
111-80-8 |
EINECS |
203-909-2 |
Struktur Molekul |
|
Kepadatan |
0.932g/cm3 |
Titik didih |
233.1°C at 760 mmHg |
Indeks bias |
1.446 |
Titik nyala |
100.6°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|