उत्पाद का नाम |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
आणविक फार्मूला |
C7H11FO2 |
आण्विक वजन |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
कैस रजिस्टी संख्या |
1171-47-7 |
आणविक संरचना |
|
घनत्व |
1.159g/cm3 |
उबलने का समय |
227.566°C at 760 mmHg |
अपवर्तक सूचकांक |
1.454 |
फ्लैश प्वाइंट |
91.429°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|