Nome del prodotto |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
Formula molecolare |
C7H11FO2 |
Peso Molecolare |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
Numero CAS |
1171-47-7 |
Struttura molecolare |
|
Densità |
1.159g/cm3 |
Punto di ebollizione |
227.566°C at 760 mmHg |
Indice di rifrazione |
1.454 |
Punto d'infiammabilità |
91.429°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|