نام محصول |
Chlorodibromomethane |
مترادف |
Dibromochloromethane |
میدان مغناطیسی |
CHBr2Cl |
وزن مولکولی |
208.2796 |
InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
شماره سیایاس |
124-48-1 |
تعداد کمیسیون اروپایی |
204-704-0 |
ساختار مولکولی |
|
تراکم |
2.504g/cm3 |
نقطه ذوب |
-22℃ |
نقطه غلیان |
117.1°C at 760 mmHg |
ضریب شکست |
1.561 |
نقطه اشتعال |
19.8°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|