اسم المنتج |
Chlorodibromomethane |
الاسم المستعار |
Dibromochloromethane |
الصيغة الجزيئية |
CHBr2Cl |
الوزن الجزيئي الغرامي |
208.2796 |
InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
إستراتيجية المساعدة القطرية |
124-48-1 |
المفوضية الأوروبية رقم |
204-704-0 |
بنية جزيئية |
|
كثافة |
2.504g/cm3 |
درجة الإنصهار |
-22℃ |
نقطة الغليان |
117.1°C at 760 mmHg |
معامل الإنكسار |
1.561 |
نقطة الوميض |
19.8°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|