상품명칭 |
4-Fluoro-3-methoxybenzaldehyde |
별명 |
4-Fluoro-m-anisaldehyde; 3-Methoxy-4-Fluorobenzaldehyde |
분자식 |
C8H7FO2 |
분자량 |
154.1384 |
InChI |
InChI=1/C8H7FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-5H,1H3 |
cas번호 |
128495-46-5 |
분자 구조 |
|
밀도 |
1.192g/cm3 |
녹는 점 |
61-63℃ |
비등점 |
246.3°C at 760 mmHg |
굴절 지수 |
1.525 |
인화점 |
99.8°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|