Naam product |
4-Fluoro-3-methoxybenzaldehyde |
Synoniemen |
4-Fluoro-m-anisaldehyde; 3-Methoxy-4-Fluorobenzaldehyde |
MF |
C8H7FO2 |
Molecuulgewicht |
154.1384 |
InChI |
InChI=1/C8H7FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-5H,1H3 |
CAS-nummer |
128495-46-5 |
Moleculaire Structuur |
|
Dichtheid |
1.192g/cm3 |
Smeltpunt |
61-63℃ |
Kookpunt |
246.3°C at 760 mmHg |
Brekingsindex |
1.525 |
Vlampunt |
99.8°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|