उत्पाद का नाम |
Penta-Chloro Thiophenol |
समानार्थी |
Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
आणविक फार्मूला |
C6HCl5S |
आण्विक वजन |
282.4021 |
InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
कैस रजिस्टी संख्या |
133-49-3 |
EINECS |
205-107-8 |
आणविक संरचना |
|
घनत्व |
1.745g/cm3 |
गलनांक |
223-227℃ |
उबलने का समय |
351.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.648 |
फ्लैश प्वाइंट |
144.6°C |
खतरे के कोड |
R20/22:Harmful by inhalation and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|