상품명칭 |
Penta-Chloro Thiophenol |
별명 |
Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
분자식 |
C6HCl5S |
분자량 |
282.4021 |
InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
cas번호 |
133-49-3 |
EC번호 |
205-107-8 |
분자 구조 |
|
밀도 |
1.745g/cm3 |
녹는 점 |
223-227℃ |
비등점 |
351.3°C at 760 mmHg |
굴절 지수 |
1.648 |
인화점 |
144.6°C |
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|