product Name |
(S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol |
Synonyms |
(1S)-1-(2-Chlorophenyl)ethane-1,2-diol |
Molecular Formula |
C8H9ClO2 |
Molecular Weight |
172.6089 |
InChI |
InChI=1/C8H9ClO2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,10-11H,5H2/t8-/m1/s1 |
CAS Registry Number |
133082-13-0 |
Molecular Structure |
|
Density |
1.328g/cm3 |
Melting point |
68-75℃ |
Boiling point |
322°C at 760 mmHg |
Refractive index |
1.588 |
Flash point |
148.5°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|