상품명칭 |
(S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol |
별명 |
(1S)-1-(2-Chlorophenyl)ethane-1,2-diol |
분자식 |
C8H9ClO2 |
분자량 |
172.6089 |
InChI |
InChI=1/C8H9ClO2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,10-11H,5H2/t8-/m1/s1 |
cas번호 |
133082-13-0 |
분자 구조 |
|
밀도 |
1.328g/cm3 |
녹는 점 |
68-75℃ |
비등점 |
322°C at 760 mmHg |
굴절 지수 |
1.588 |
인화점 |
148.5°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|