termék neve |
1,2-diethylbenzene |
Szinonimák |
Diethylbenzene; o-Diethylbenzene |
MF |
C10H14 |
Molekulatömeg |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
CAS-szám |
135-01-3 |
EINECS |
205-170-1 |
Molekuláris szerkezete |
|
Sűrűség |
0.865g/cm3 |
Forráspont |
183.5°C at 760 mmHg |
Törésmutató |
1.496 |
Gyulladáspont |
49.4°C |
Kockázatot kódok |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|