اسم المنتج |
1,2-diethylbenzene |
الاسم المستعار |
Diethylbenzene; o-Diethylbenzene |
الصيغة الجزيئية |
C10H14 |
الوزن الجزيئي الغرامي |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
إستراتيجية المساعدة القطرية |
135-01-3 |
المفوضية الأوروبية رقم |
205-170-1 |
بنية جزيئية |
|
كثافة |
0.865g/cm3 |
نقطة الغليان |
183.5°C at 760 mmHg |
معامل الإنكسار |
1.496 |
نقطة الوميض |
49.4°C |
خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|