product Name |
2',3',4'-Trichloroacetophenone |
Synonyms |
1-(2,3,4-Trichlorophenyl)ethanone; 2,3,4-Trichloroacetophenone |
Molecular Formula |
C8H5Cl3O |
Molecular Weight |
223.4837 |
InChI |
InChI=1/C8H5Cl3O/c1-4(12)5-2-3-6(9)8(11)7(5)10/h2-3H,1H3 |
CAS Registry Number |
13608-87-2 |
EINECS |
237-092-9 |
Molecular Structure |
|
Density |
1.425g/cm3 |
Melting point |
59-64℃ |
Boiling point |
297.5°C at 760 mmHg |
Refractive index |
1.563 |
Flash point |
124.5°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|