Naam product |
2',3',4'-Trichloroacetophenone |
Synoniemen |
1-(2,3,4-Trichlorophenyl)ethanone; 2,3,4-Trichloroacetophenone |
MF |
C8H5Cl3O |
Molecuulgewicht |
223.4837 |
InChI |
InChI=1/C8H5Cl3O/c1-4(12)5-2-3-6(9)8(11)7(5)10/h2-3H,1H3 |
CAS-nummer |
13608-87-2 |
EINECS |
237-092-9 |
Moleculaire Structuur |
|
Dichtheid |
1.425g/cm3 |
Smeltpunt |
59-64℃ |
Kookpunt |
297.5°C at 760 mmHg |
Brekingsindex |
1.563 |
Vlampunt |
124.5°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|