Produkt-Name |
9-Fluorenone hydrazone |
Synonyme |
Fluorenone hydrazone
; 9H-Fluoren-9-one hydrazone; 9H-fluoren-9-ylidenehydrazine |
Molekulare Formel |
C13H10N2 |
Molecular Weight |
194.2319 |
InChI |
InChI=1/C13H10N2/c14-15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H,14H2 |
CAS Registry Number |
13629-22-6 |
EINECS |
237-116-8 |
Molecular Structure |
|
Dichte |
1.23g/cm3 |
Schmelzpunkt |
149-150℃ |
Siedepunkt |
362.5°C at 760 mmHg |
Brechungsindex |
1.682 |
Flammpunkt |
173°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|