Nama produk |
9-Fluorenone hydrazone |
Sinonim |
Fluorenone hydrazone
; 9H-Fluoren-9-one hydrazone; 9H-fluoren-9-ylidenehydrazine |
MF |
C13H10N2 |
Berat Molekul |
194.2319 |
InChI |
InChI=1/C13H10N2/c14-15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H,14H2 |
CAS NO |
13629-22-6 |
EINECS |
237-116-8 |
Struktur Molekul |
|
Kepadatan |
1.23g/cm3 |
Titik lebur |
149-150℃ |
Titik didih |
362.5°C at 760 mmHg |
Indeks bias |
1.682 |
Titik nyala |
173°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|