Nome del prodotto |
2-acetyl-3-methylthiophene |
Sinonimi |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
Formula molecolare |
C7H8OS |
Peso Molecolare |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
Numero CAS |
13679-72-6 |
EINECS |
237-179-1 |
Struttura molecolare |
|
Densità |
1.106g/cm3 |
Punto di ebollizione |
214.9°C at 760 mmHg |
Indice di rifrazione |
1.535 |
Punto d'infiammabilità |
92.3°C |
Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|