상품명칭 |
2-acetyl-3-methylthiophene |
별명 |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
분자식 |
C7H8OS |
분자량 |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
cas번호 |
13679-72-6 |
EC번호 |
237-179-1 |
분자 구조 |
|
밀도 |
1.106g/cm3 |
비등점 |
214.9°C at 760 mmHg |
굴절 지수 |
1.535 |
인화점 |
92.3°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|