نام محصول |
3-Methyl-4-phenylpyrazole |
مترادف |
3-Methyl-4-phenylpyrazol; 3-methyl-4-phenyl-1H-pyrazole |
میدان مغناطیسی |
C10H10N2 |
وزن مولکولی |
158.1998 |
InChI |
InChI=1/C10H10N2/c1-8-10(7-11-12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) |
شماره سیایاس |
13788-84-6 |
ساختار مولکولی |
|
تراکم |
1.109g/cm3 |
نقطه ذوب |
142-144℃ |
نقطه غلیان |
321.2°C at 760 mmHg |
ضریب شکست |
1.591 |
نقطه اشتعال |
148.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|