produktnavn |
3-Methyl-4-phenylpyrazole |
Synonymer |
3-Methyl-4-phenylpyrazol; 3-methyl-4-phenyl-1H-pyrazole |
Molekylær Formel |
C10H10N2 |
Molekylvekt |
158.1998 |
InChI |
InChI=1/C10H10N2/c1-8-10(7-11-12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) |
CAS-nummer |
13788-84-6 |
Molecular Structure |
|
Tetthet |
1.109g/cm3 |
Smeltepunkt |
142-144℃ |
Kokepunkt |
321.2°C at 760 mmHg |
Brytningsindeks |
1.591 |
Flammepunktet |
148.4°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|