نام محصول |
2,4,5-trifluorobenzyl alcohol |
مترادف |
(2,4,5-trifluorophenyl)methanol |
میدان مغناطیسی |
C7H5F3O |
وزن مولکولی |
162.11 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
شماره سیایاس |
144284-25-3 |
ساختار مولکولی |
|
تراکم |
1.858g/cm3 |
نقطه غلیان |
213.308°C at 760 mmHg |
ضریب شکست |
1.55 |
نقطه اشتعال |
82.806°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|