produktnavn |
2,4,5-trifluorobenzyl alcohol |
Synonymer |
(2,4,5-trifluorophenyl)methanol |
Molekylær Formel |
C7H5F3O |
Molekylvekt |
162.11 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
CAS-nummer |
144284-25-3 |
Molecular Structure |
|
Tetthet |
1.858g/cm3 |
Kokepunkt |
213.308°C at 760 mmHg |
Brytningsindeks |
1.55 |
Flammepunktet |
82.806°C |
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|