상품명칭 |
Diethyl phenyl orthoformate |
별명 |
Orthoformic acid diethyl phenyl ester; (diethoxymethoxy)benzene |
분자식 |
C11H16O3 |
분자량 |
196.2429 |
InChI |
InChI=1/C11H16O3/c1-3-12-11(13-4-2)14-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
cas번호 |
14444-77-0 |
EC번호 |
238-421-9 |
분자 구조 |
|
밀도 |
1.019g/cm3 |
비등점 |
235.2°C at 760 mmHg |
굴절 지수 |
1.482 |
인화점 |
57.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|