Naam product |
Diethyl phenyl orthoformate |
Synoniemen |
Orthoformic acid diethyl phenyl ester; (diethoxymethoxy)benzene |
MF |
C11H16O3 |
Molecuulgewicht |
196.2429 |
InChI |
InChI=1/C11H16O3/c1-3-12-11(13-4-2)14-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
CAS-nummer |
14444-77-0 |
EINECS |
238-421-9 |
Moleculaire Structuur |
|
Dichtheid |
1.019g/cm3 |
Kookpunt |
235.2°C at 760 mmHg |
Brekingsindex |
1.482 |
Vlampunt |
57.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|