product Name |
3-Methylthianaphthene-2-acetic acid |
Synonyms |
2-(3-Methylbenzo[b]thiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetate |
Molecular Formula |
C11H9O2S |
Molecular Weight |
205.2535 |
InChI |
InChI=1/C11H10O2S/c1-7-8-4-2-3-5-9(8)14-10(7)6-11(12)13/h2-5H,6H2,1H3,(H,12,13)/p-1 |
CAS Registry Number |
1505-52-8 |
Molecular Structure |
|
Melting point |
148-150℃ |
Boiling point |
391.8°C at 760 mmHg |
Flash point |
190.8°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|