Naam product |
3-Methylthianaphthene-2-acetic acid |
Synoniemen |
2-(3-Methylbenzo[b]thiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetate |
MF |
C11H9O2S |
Molecuulgewicht |
205.2535 |
InChI |
InChI=1/C11H10O2S/c1-7-8-4-2-3-5-9(8)14-10(7)6-11(12)13/h2-5H,6H2,1H3,(H,12,13)/p-1 |
CAS-nummer |
1505-52-8 |
Moleculaire Structuur |
|
Smeltpunt |
148-150℃ |
Kookpunt |
391.8°C at 760 mmHg |
Vlampunt |
190.8°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|