Produkt-Name |
Iodocyclopentane |
Synonyme |
Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
Molekulare Formel |
C8H7NOS |
Molecular Weight |
165.2123 |
InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
CAS Registry Number |
1556-18-9 |
EINECS |
216-311-1 |
Molecular Structure |
|
Dichte |
1.08g/cm3 |
Siedepunkt |
280.5°C at 760 mmHg |
Brechungsindex |
1.551 |
Flammpunkt |
123.4°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|