نام محصول |
Iodocyclopentane |
مترادف |
Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
میدان مغناطیسی |
C8H7NOS |
وزن مولکولی |
165.2123 |
InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
شماره سیایاس |
1556-18-9 |
تعداد کمیسیون اروپایی |
216-311-1 |
ساختار مولکولی |
|
تراکم |
1.08g/cm3 |
نقطه غلیان |
280.5°C at 760 mmHg |
ضریب شکست |
1.551 |
نقطه اشتعال |
123.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|