product Name |
2-Cyano-4-methylpyridine |
Synonyms |
2-Cyano-4-picoline; 4-Methylpicolinonitrile; 4-Methyl-2-pyridinecarbonitrile; 4-methylpyridine-2-carbonitrile |
Molecular Formula |
C7H6N2 |
Molecular Weight |
118.1359 |
InChI |
InChI=1/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
CAS Registry Number |
1620-76-4 |
EINECS |
244-131-3 |
Molecular Structure |
|
Density |
1.08g/cm3 |
Boiling point |
261.1°C at 760 mmHg |
Refractive index |
1.531 |
Flash point |
99.9°C |
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|