Nama produk |
2-Cyano-4-methylpyridine |
Sinonim |
2-Cyano-4-picoline; 4-Methylpicolinonitrile; 4-Methyl-2-pyridinecarbonitrile; 4-methylpyridine-2-carbonitrile |
MF |
C7H6N2 |
Berat Molekul |
118.1359 |
InChI |
InChI=1/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
CAS NO |
1620-76-4 |
EINECS |
244-131-3 |
Struktur Molekul |
|
Kepadatan |
1.08g/cm3 |
Titik didih |
261.1°C at 760 mmHg |
Indeks bias |
1.531 |
Titik nyala |
99.9°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|